C11H15BrIN3O2 — CID 114266392
2-[2-(5-bromo-2-iodoanilino)ethoxy]-N'-hydroxypropanimidamide (PubChem CID 114266392) has the molecular formula C11H15BrIN3O2 and a molecular weight of 428.07 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-iodoanilino)ethoxy]-N'-hydroxypropanimidamide.
| Compound Name | 2-[2-(5-bromo-2-iodoanilino)ethoxy]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 114266392 |
| Molecular Formula | C11H15BrIN3O2 |
| Molecular Weight | 428.07 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 2-[2-(5-bromo-2-iodoanilino)ethoxy]-N'-hydroxypropanimidamide |
| SMILES | CC(OCCNc1cc(Br)ccc1I)/C(N)=N/O |
| InChI | InChI=1S/C11H15BrIN3O2/c1-7(11(14)16-17)18-5-4-15-10-6-8(12)2-3-9(10)13/h2-3,6-7,15,17H,4-5H2,1H3,(H2,14,16) |
| InChIKey | SCASIYQMKYCVOT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|