C13H21FN2O2 — CID 114270472
3-(2-ethoxy-3-fluoro-4-pyridinyl)-N-(2-methoxyethyl)propan-1-amine (PubChem CID 114270472) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-(2-ethoxy-3-fluoro-4-pyridinyl)-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-(2-ethoxy-3-fluoro-4-pyridinyl)-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 114270472 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(2-ethoxy-3-fluoro-4-pyridinyl)-N-(2-methoxyethyl)propan-1-amine |
| SMILES | CCOc1nccc(CCCNCCOC)c1F |
| InChI | InChI=1S/C13H21FN2O2/c1-3-18-13-12(14)11(6-8-16-13)5-4-7-15-9-10-17-2/h6,8,15H,3-5,7,9-10H2,1-2H3 |
| InChIKey | XXESAAXDJKDBNR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|