C18H34O3Si — CID 11427373
[(2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl] 2-methylprop-2-enoate (PubChem CID 11427373) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is [(2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11427373 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C[C@H](C)[C@H](OC(=O)C(=C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-11-14(4)16(21-17(19)13(2)3)15(5)12-20-22(9,10)18(6,7)8/h11,14-16H,1-2,12H2,3-10H3/t14-,15-,16-/m0/s1 |
| InChIKey | OIDLOPWSPYFZFF-JYJNAYRXSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|