C11H10IN3O2 — CID 114274531
4-[(2-iodoanilino)methyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 114274531) has the molecular formula C11H10IN3O2 and a molecular weight of 343.12 g/mol. Its IUPAC name is 4-[(2-iodoanilino)methyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[(2-iodoanilino)methyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114274531 |
| Molecular Formula | C11H10IN3O2 |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 4-[(2-iodoanilino)methyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]ncc1CNc1ccccc1I |
| InChI | InChI=1S/C11H10IN3O2/c12-8-3-1-2-4-9(8)13-5-7-6-14-15-10(7)11(16)17/h1-4,6,13H,5H2,(H,14,15)(H,16,17) |
| InChIKey | FJUIMPNLUFBLPU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|