C15H13IN4 — CID 43773509
2-iodo-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 43773509) has the molecular formula C15H13IN4 and a molecular weight of 376.20 g/mol. Its IUPAC name is 2-iodo-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 2-iodo-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43773509 |
| Molecular Formula | C15H13IN4 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-iodo-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Ic1ccccc1NCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C15H13IN4/c16-13-5-1-2-6-14(13)18-9-12-10-19-20-15(12)11-4-3-7-17-8-11/h1-8,10,18H,9H2,(H,19,20) |
| InChIKey | PIZYOXMOXQOPLY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|