C12H11N3O5S — CID 67540971
4-[[2-(benzenesulfonyl)acetyl]amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 67540971) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-[[2-(benzenesulfonyl)acetyl]amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[[2-(benzenesulfonyl)acetyl]amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67540971 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-[[2-(benzenesulfonyl)acetyl]amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1cn[nH]c1C(=O)O |
| InChI | InChI=1S/C12H11N3O5S/c16-10(14-9-6-13-15-11(9)12(17)18)7-21(19,20)8-4-2-1-3-5-8/h1-6H,7H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | OFEDDNZBMUQTKK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |