C16H14N2O3S2 — CID 112779741
2-(benzenesulfonyl)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide (PubChem CID 112779741) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 112779741 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-(benzenesulfonyl)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3S2/c17-10-11-22-15-9-5-4-8-14(15)18-16(19)12-23(20,21)13-6-2-1-3-7-13/h1-9H,11-12H2,(H,18,19) |
| InChIKey | LBBVQPKRIFXVRV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |