C16H14BrN3OS — CID 42069221
2-(2-bromoanilino)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide (PubChem CID 42069221) has the molecular formula C16H14BrN3OS and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-(2-bromoanilino)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(2-bromoanilino)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42069221 |
| Molecular Formula | C16H14BrN3OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 2-(2-bromoanilino)-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CNc1ccccc1Br |
| InChI | InChI=1S/C16H14BrN3OS/c17-12-5-1-2-6-13(12)19-11-16(21)20-14-7-3-4-8-15(14)22-10-9-18/h1-8,19H,10-11H2,(H,20,21) |
| InChIKey | WROIUPJTNHBWSJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |