C22H19N3OS2 — CID 42068568
N-[2-(cyanomethylsulfanyl)phenyl]-2-(2-phenylsulfanylanilino)acetamide (PubChem CID 42068568) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-(2-phenylsulfanylanilino)acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-(2-phenylsulfanylanilino)acetamide |
|---|---|
| PubChem CID | 42068568 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-(2-phenylsulfanylanilino)acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CNc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C22H19N3OS2/c23-14-15-27-20-12-6-5-11-19(20)25-22(26)16-24-18-10-4-7-13-21(18)28-17-8-2-1-3-9-17/h1-13,24H,15-16H2,(H,25,26) |
| InChIKey | IJIJNZUSYJTCIG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |