C17H14N2O4S — CID 46506897
2-(benzenesulfonyl)-N-(4-phenyl-1,2-oxazol-5-yl)acetamide (PubChem CID 46506897) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(4-phenyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(4-phenyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 46506897 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(4-phenyl-1,2-oxazol-5-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1oncc1-c1ccccc1 |
| InChI | InChI=1S/C17H14N2O4S/c20-16(12-24(21,22)14-9-5-2-6-10-14)19-17-15(11-18-23-17)13-7-3-1-4-8-13/h1-11H,12H2,(H,19,20) |
| InChIKey | RYWTWTZUUPAOLK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |