C18H27N3O4 — CID 114274937
benzyl (3S)-3-amino-4-[methyl-[2-(2-methylpropylamino)-2-oxoethyl]amino]-4-oxobutanoate (PubChem CID 114274937) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-[methyl-[2-(2-methylpropylamino)-2-oxoethyl]amino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-[methyl-[2-(2-methylpropylamino)-2-oxoethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 114274937 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | benzyl (3S)-3-amino-4-[methyl-[2-(2-methylpropylamino)-2-oxoethyl]amino]-4-oxobutanoate |
| SMILES | CC(C)CNC(=O)CN(C)C(=O)[C@@H](N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27N3O4/c1-13(2)10-20-16(22)11-21(3)18(24)15(19)9-17(23)25-12-14-7-5-4-6-8-14/h4-8,13,15H,9-12,19H2,1-3H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | ISOLJDINQCLQJA-HNNXBMFYSA-N |
| XLogP | 0.68 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |