C16H24O2S — CID 114276173
tert-butyl 4-cyclopropyl-5-(2-methylpropyl)thiophene-3-carboxylate (PubChem CID 114276173) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is tert-butyl 4-cyclopropyl-5-(2-methylpropyl)thiophene-3-carboxylate.
| Compound Name | tert-butyl 4-cyclopropyl-5-(2-methylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 114276173 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl 4-cyclopropyl-5-(2-methylpropyl)thiophene-3-carboxylate |
| SMILES | CC(C)Cc1scc(C(=O)OC(C)(C)C)c1C1CC1 |
| InChI | InChI=1S/C16H24O2S/c1-10(2)8-13-14(11-6-7-11)12(9-19-13)15(17)18-16(3,4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | CKTIZENLQRXAKO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |