C17H23NO4S — CID 70125768
ditert-butyl 5H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 70125768) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is ditert-butyl 5H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | ditert-butyl 5H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 70125768 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ditert-butyl 5H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1csc2c1=CCN(C(=O)OC(C)(C)C)C=2 |
| InChI | InChI=1S/C17H23NO4S/c1-16(2,3)21-14(19)12-10-23-13-9-18(8-7-11(12)13)15(20)22-17(4,5)6/h7,9-10H,8H2,1-6H3 |
| InChIKey | OBLXWIJHXMTJFO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |