C12H18N2O4 — CID 114276446
2-(4-methoxybutyl)-5,6-dimethyl-3-oxopyridazine-4-carboxylic acid (PubChem CID 114276446) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(4-methoxybutyl)-5,6-dimethyl-3-oxopyridazine-4-carboxylic acid.
| Compound Name | 2-(4-methoxybutyl)-5,6-dimethyl-3-oxopyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 114276446 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(4-methoxybutyl)-5,6-dimethyl-3-oxopyridazine-4-carboxylic acid |
| SMILES | COCCCCn1nc(C)c(C)c(C(=O)O)c1=O |
| InChI | InChI=1S/C12H18N2O4/c1-8-9(2)13-14(6-4-5-7-18-3)11(15)10(8)12(16)17/h4-7H2,1-3H3,(H,16,17) |
| InChIKey | XXANKQIDDRNCFE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|