C14H22N2O — CID 114277135
N-methoxy-N-(1,2,3,4-tetrahydroquinolin-4-ylmethyl)propan-1-amine (PubChem CID 114277135) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-methoxy-N-(1,2,3,4-tetrahydroquinolin-4-ylmethyl)propan-1-amine.
| Compound Name | N-methoxy-N-(1,2,3,4-tetrahydroquinolin-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 114277135 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-methoxy-N-(1,2,3,4-tetrahydroquinolin-4-ylmethyl)propan-1-amine |
| SMILES | CCCN(CC1CCNc2ccccc21)OC |
| InChI | InChI=1S/C14H22N2O/c1-3-10-16(17-2)11-12-8-9-15-14-7-5-4-6-13(12)14/h4-7,12,15H,3,8-11H2,1-2H3 |
| InChIKey | VUIPYBAJNXFKQT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|