C11H14BrN3O2 — CID 114277900
(5-bromofuran-2-yl)-[2-(2-methoxyethyl)pyrazol-3-yl]methanamine (PubChem CID 114277900) has the molecular formula C11H14BrN3O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[2-(2-methoxyethyl)pyrazol-3-yl]methanamine.
| Compound Name | (5-bromofuran-2-yl)-[2-(2-methoxyethyl)pyrazol-3-yl]methanamine |
|---|---|
| PubChem CID | 114277900 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (5-bromofuran-2-yl)-[2-(2-methoxyethyl)pyrazol-3-yl]methanamine |
| SMILES | COCCn1nccc1C(N)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H14BrN3O2/c1-16-7-6-15-8(4-5-14-15)11(13)9-2-3-10(12)17-9/h2-5,11H,6-7,13H2,1H3 |
| InChIKey | XHFCIKQPYXSKCC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |