C12H17N3OS — CID 114277911
[2-(2-methoxyethyl)pyrazol-3-yl]-(3-methylthiophen-2-yl)methanamine (PubChem CID 114277911) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is [2-(2-methoxyethyl)pyrazol-3-yl]-(3-methylthiophen-2-yl)methanamine.
| Compound Name | [2-(2-methoxyethyl)pyrazol-3-yl]-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 114277911 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | [2-(2-methoxyethyl)pyrazol-3-yl]-(3-methylthiophen-2-yl)methanamine |
| SMILES | COCCn1nccc1C(N)c1sccc1C |
| InChI | InChI=1S/C12H17N3OS/c1-9-4-8-17-12(9)11(13)10-3-5-14-15(10)6-7-16-2/h3-5,8,11H,6-7,13H2,1-2H3 |
| InChIKey | KLUDOFPUPRGGBB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |