C12H16BrN3OS — CID 114278098
(3-bromothiophen-2-yl)-[2-(3-methoxypropyl)pyrazol-3-yl]methanamine (PubChem CID 114278098) has the molecular formula C12H16BrN3OS and a molecular weight of 330.25 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-[2-(3-methoxypropyl)pyrazol-3-yl]methanamine.
| Compound Name | (3-bromothiophen-2-yl)-[2-(3-methoxypropyl)pyrazol-3-yl]methanamine |
|---|---|
| PubChem CID | 114278098 |
| Molecular Formula | C12H16BrN3OS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | (3-bromothiophen-2-yl)-[2-(3-methoxypropyl)pyrazol-3-yl]methanamine |
| SMILES | COCCCn1nccc1C(N)c1sccc1Br |
| InChI | InChI=1S/C12H16BrN3OS/c1-17-7-2-6-16-10(3-5-15-16)11(14)12-9(13)4-8-18-12/h3-5,8,11H,2,6-7,14H2,1H3 |
| InChIKey | LTZQKGBSEPWJMB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|