C11H17N5OS — CID 114277902
N-[[2-(2-methoxyethyl)pyrazol-3-yl]-(thiadiazol-4-yl)methyl]ethanamine (PubChem CID 114277902) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is N-[[2-(2-methoxyethyl)pyrazol-3-yl]-(thiadiazol-4-yl)methyl]ethanamine.
| Compound Name | N-[[2-(2-methoxyethyl)pyrazol-3-yl]-(thiadiazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114277902 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[[2-(2-methoxyethyl)pyrazol-3-yl]-(thiadiazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1csnn1)c1ccnn1CCOC |
| InChI | InChI=1S/C11H17N5OS/c1-3-12-11(9-8-18-15-14-9)10-4-5-13-16(10)6-7-17-2/h4-5,8,11-12H,3,6-7H2,1-2H3 |
| InChIKey | JSJZAXSWKNGVAV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |