C14H19FO2S — CID 114280185
2-(5-fluoropentylsulfanyl)-3-phenylpropanoic acid (PubChem CID 114280185) has the molecular formula C14H19FO2S and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(5-fluoropentylsulfanyl)-3-phenylpropanoic acid.
| Compound Name | 2-(5-fluoropentylsulfanyl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 114280185 |
| Molecular Formula | C14H19FO2S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(5-fluoropentylsulfanyl)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)SCCCCCF |
| InChI | InChI=1S/C14H19FO2S/c15-9-5-2-6-10-18-13(14(16)17)11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,17) |
| InChIKey | VNUUWATVHVRZIR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|