C32H30O2S2 — CID 175703291
2-[2-(1-oxo-1,3-diphenylpropan-2-yl)sulfanylethylsulfanyl]-1,3-diphenylpropan-1-one (PubChem CID 175703291) has the molecular formula C32H30O2S2 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-[2-(1-oxo-1,3-diphenylpropan-2-yl)sulfanylethylsulfanyl]-1,3-diphenylpropan-1-one.
| Compound Name | 2-[2-(1-oxo-1,3-diphenylpropan-2-yl)sulfanylethylsulfanyl]-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 175703291 |
| Molecular Formula | C32H30O2S2 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 2-[2-(1-oxo-1,3-diphenylpropan-2-yl)sulfanylethylsulfanyl]-1,3-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(Cc1ccccc1)SCCSC(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H30O2S2/c33-31(27-17-9-3-10-18-27)29(23-25-13-5-1-6-14-25)35-21-22-36-30(24-26-15-7-2-8-16-26)32(34)28-19-11-4-12-20-28/h1-20,29-30H,21-24H2 |
| InChIKey | CKYZYGANQYNYLK-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|