C16H16O3S — CID 135042830
(2S)-2-methylsulfonyl-1,3-diphenylpropan-1-one (PubChem CID 135042830) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is (2S)-2-methylsulfonyl-1,3-diphenylpropan-1-one.
| Compound Name | (2S)-2-methylsulfonyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 135042830 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (2S)-2-methylsulfonyl-1,3-diphenylpropan-1-one |
| SMILES | CS(=O)(=O)[C@@H](Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O3S/c1-20(18,19)15(12-13-8-4-2-5-9-13)16(17)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3/t15-/m0/s1 |
| InChIKey | CYFANAHTQSIFAW-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |