C14H20BrNS — CID 114282776
1-(2-bromophenyl)-N-(thian-3-ylmethyl)ethanamine (PubChem CID 114282776) has the molecular formula C14H20BrNS and a molecular weight of 314.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-(thian-3-ylmethyl)ethanamine.
| Compound Name | 1-(2-bromophenyl)-N-(thian-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 114282776 |
| Molecular Formula | C14H20BrNS |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(2-bromophenyl)-N-(thian-3-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCCSC1)c1ccccc1Br |
| InChI | InChI=1S/C14H20BrNS/c1-11(13-6-2-3-7-14(13)15)16-9-12-5-4-8-17-10-12/h2-3,6-7,11-12,16H,4-5,8-10H2,1H3 |
| InChIKey | JEQFZWPHBBPMPU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |