C15H26N2 — CID 114284954
N-ethyl-3,5-dimethyl-2-pyridin-3-ylhexan-1-amine (PubChem CID 114284954) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-2-pyridin-3-ylhexan-1-amine.
| Compound Name | N-ethyl-3,5-dimethyl-2-pyridin-3-ylhexan-1-amine |
|---|---|
| PubChem CID | 114284954 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-ethyl-3,5-dimethyl-2-pyridin-3-ylhexan-1-amine |
| SMILES | CCNCC(c1cccnc1)C(C)CC(C)C |
| InChI | InChI=1S/C15H26N2/c1-5-16-11-15(13(4)9-12(2)3)14-7-6-8-17-10-14/h6-8,10,12-13,15-16H,5,9,11H2,1-4H3 |
| InChIKey | IMHLOWYWVJMPOF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |