C13H14F2N2O2 — CID 114291079
2-cyano-N-[2-(difluoromethoxy)phenyl]-2-methylbutanamide (PubChem CID 114291079) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-cyano-N-[2-(difluoromethoxy)phenyl]-2-methylbutanamide.
| Compound Name | 2-cyano-N-[2-(difluoromethoxy)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 114291079 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-cyano-N-[2-(difluoromethoxy)phenyl]-2-methylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H14F2N2O2/c1-3-13(2,8-16)11(18)17-9-6-4-5-7-10(9)19-12(14)15/h4-7,12H,3H2,1-2H3,(H,17,18) |
| InChIKey | ZHQFRMGVDCBOHH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |