C11H18N2O2 — CID 114291464
2-methyl-2-(1,4-oxazepane-4-carbonyl)butanenitrile (PubChem CID 114291464) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-methyl-2-(1,4-oxazepane-4-carbonyl)butanenitrile.
| Compound Name | 2-methyl-2-(1,4-oxazepane-4-carbonyl)butanenitrile |
|---|---|
| PubChem CID | 114291464 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-methyl-2-(1,4-oxazepane-4-carbonyl)butanenitrile |
| SMILES | CCC(C)(C#N)C(=O)N1CCCOCC1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-11(2,9-12)10(14)13-5-4-7-15-8-6-13/h3-8H2,1-2H3 |
| InChIKey | MORSESUHMTYMQB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |