C23H26N2O4 — CID 11429331
(5S,6R)-3-[(E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 11429331) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (5S,6R)-3-[(E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-3-[(E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 11429331 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (5S,6R)-3-[(E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)O[C@H](c2ccccc2)[C@H](C)N1C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-16(20(26)15-14-18-10-6-4-7-11-18)22(27)25-23(28)29-21(17(2)24(25)3)19-12-8-5-9-13-19/h4-17,20-21,26H,1-3H3/b15-14+/t16-,17-,20+,21-/m0/s1 |
| InChIKey | RYHYGZHYWBTYAI-VPYWNSOPSA-N |
| XLogP | 3.65 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |