C10H16BrN3O2S — CID 114293726
N-[1-(bromomethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide (PubChem CID 114293726) has the molecular formula C10H16BrN3O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(bromomethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114293726 |
| Molecular Formula | C10H16BrN3O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[1-(bromomethyl)cyclohexyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NC1(CBr)CCCCC1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H16BrN3O2S/c11-8-10(4-2-1-3-5-10)14-17(15,16)9-6-12-13-7-9/h6-7,14H,1-5,8H2,(H,12,13) |
| InChIKey | PFWPGCBPJJFITM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|