About (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide
(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide (PubChem CID 11429435) has the molecular formula C22H24F2N4O
and a molecular weight of 398.46 g/mol. Its IUPAC name is (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide.
Molecular Properties
| Compound Name | (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide |
| PubChem CID | 11429435 |
| Molecular Formula | C22H24F2N4O |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide |
| SMILES | CCC[C@H](NCCc1cccc(F)c1F)C(=O)Nc1cc(-c2ccccc2)[nH]n1 |
| InChI | InChI=1S/C22H24F2N4O/c1-2-7-18(25-13-12-16-10-6-11-17(23)21(16)24)22(29)26-20-14-19(27-28-20)15-8-4-3-5-9-15/h3-6,8-11,14,18,25H,2,7,12-13H2,1H3,(H2,26,27,28,29)/t18-/m0/s1 |
| InChIKey | AKPCJYAEPDEOPG-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide?
The IUPAC name of (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide (CID 11429435) is (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide.
What is the SMILES notation for (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide?
The canonical SMILES for (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide is CCC[C@H](NCCc1cccc(F)c1F)C(=O)Nc1cc(-c2ccccc2)[nH]n1.
What is the InChIKey of (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide?
The InChIKey is AKPCJYAEPDEOPG-SFHVURJKSA-N. The full InChI is InChI=1S/C22H24F2N4O/c1-2-7-18(25-13-12-16-10-6-11-17(23)21(16)24)22(29)26-20-14-19(27-28-20)15-8-4-3-5-9-15/h3-6,8-11,14,18,25H,2,7,12-13H2,1H3,(H2,26,27,28,29)/t18-/m0/s1.
What are the key properties of (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide?
(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide has a molecular weight of 398.46 g/mol, XLogP of 4.29, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2-(2,3-difluorophenyl)ethylamino]-N-(5-phenyl-1H-pyrazol-3-yl)pentanamide is sourced from PubChem (CID 11429435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).