C18H28F2N2O2 — CID 90433961
ethyl (2S)-5-[2-[2-(2,3-difluorophenyl)ethyl]hydrazinyl]-2-propylpentanoate (PubChem CID 90433961) has the molecular formula C18H28F2N2O2 and a molecular weight of 342.43 g/mol. Its IUPAC name is ethyl (2S)-5-[2-[2-(2,3-difluorophenyl)ethyl]hydrazinyl]-2-propylpentanoate.
| Compound Name | ethyl (2S)-5-[2-[2-(2,3-difluorophenyl)ethyl]hydrazinyl]-2-propylpentanoate |
|---|---|
| PubChem CID | 90433961 |
| Molecular Formula | C18H28F2N2O2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | ethyl (2S)-5-[2-[2-(2,3-difluorophenyl)ethyl]hydrazinyl]-2-propylpentanoate |
| SMILES | CCC[C@@H](CCCNNCCc1cccc(F)c1F)C(=O)OCC |
| InChI | InChI=1S/C18H28F2N2O2/c1-3-7-15(18(23)24-4-2)9-6-12-21-22-13-11-14-8-5-10-16(19)17(14)20/h5,8,10,15,21-22H,3-4,6-7,9,11-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | GGDRWEDPEUKHHM-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|