C23H25F2N3O4 — CID 140542343
[(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-5,5-dihydroxypentyl] N-isoquinolin-3-ylcarbamate (PubChem CID 140542343) has the molecular formula C23H25F2N3O4 and a molecular weight of 445.47 g/mol. Its IUPAC name is [(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-5,5-dihydroxypentyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-5,5-dihydroxypentyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 140542343 |
| Molecular Formula | C23H25F2N3O4 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [(2S)-2-[2-(2,3-difluorophenyl)ethylamino]-5,5-dihydroxypentyl] N-isoquinolin-3-ylcarbamate |
| SMILES | O=C(Nc1cc2ccccc2cn1)OC[C@H](CCC(O)O)NCCc1cccc(F)c1F |
| InChI | InChI=1S/C23H25F2N3O4/c24-19-7-3-6-15(22(19)25)10-11-26-18(8-9-21(29)30)14-32-23(31)28-20-12-16-4-1-2-5-17(16)13-27-20/h1-7,12-13,18,21,26,29-30H,8-11,14H2,(H,27,28,31)/t18-/m0/s1 |
| InChIKey | XBWAFXBEADZGCX-SFHVURJKSA-N |
| XLogP | 3.35 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|