C11H22BrNO2S — CID 114297081
N-[1-(bromomethyl)cyclopentyl]-2,2-dimethylpropane-1-sulfonamide (PubChem CID 114297081) has the molecular formula C11H22BrNO2S and a molecular weight of 312.27 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclopentyl]-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-[1-(bromomethyl)cyclopentyl]-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 114297081 |
| Molecular Formula | C11H22BrNO2S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-[1-(bromomethyl)cyclopentyl]-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC1(CBr)CCCC1 |
| InChI | InChI=1S/C11H22BrNO2S/c1-10(2,3)9-16(14,15)13-11(8-12)6-4-5-7-11/h13H,4-9H2,1-3H3 |
| InChIKey | QOLKIPZGKZOSRB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|