C10H12BrCl2NO2S — CID 114298130
N-(3-bromo-2-methylpropyl)-3,5-dichlorobenzenesulfonamide (PubChem CID 114298130) has the molecular formula C10H12BrCl2NO2S and a molecular weight of 361.09 g/mol. Its IUPAC name is N-(3-bromo-2-methylpropyl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(3-bromo-2-methylpropyl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114298130 |
| Molecular Formula | C10H12BrCl2NO2S |
| Molecular Weight | 361.09 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | N-(3-bromo-2-methylpropyl)-3,5-dichlorobenzenesulfonamide |
| SMILES | CC(CBr)CNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H12BrCl2NO2S/c1-7(5-11)6-14-17(15,16)10-3-8(12)2-9(13)4-10/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | CSGUYJBDBNDNNY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|