C9H16BrN3O2S — CID 114298583
N-(1-bromo-2-methylpropan-2-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 114298583) has the molecular formula C9H16BrN3O2S and a molecular weight of 310.22 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114298583 |
| Molecular Formula | C9H16BrN3O2S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC(C)(C)CBr |
| InChI | InChI=1S/C9H16BrN3O2S/c1-6-8(7(2)12-11-6)16(14,15)13-9(3,4)5-10/h13H,5H2,1-4H3,(H,11,12) |
| InChIKey | ARXKNYSZBSEBMS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|