C20H29N3O7 — CID 11430159
methyl (2S,4S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-[(4-nitrophenyl)methoxy]pyrrolidine-2-carboxylate (PubChem CID 11430159) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl (2S,4S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-[(4-nitrophenyl)methoxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-[(4-nitrophenyl)methoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11430159 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | methyl (2S,4S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-[(4-nitrophenyl)methoxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OCc2ccc([N+](=O)[O-])cc2)CN1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29N3O7/c1-20(2,3)30-19(25)21-9-10-22-12-16(11-17(22)18(24)28-4)29-13-14-5-7-15(8-6-14)23(26)27/h5-8,16-17H,9-13H2,1-4H3,(H,21,25)/t16-,17-/m0/s1 |
| InChIKey | CYGHLGZBDXPXSF-IRXDYDNUSA-N |
| XLogP | 2.25 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|