C14H21N3O — CID 114325626
2-(aminomethyl)-N-(3-methylcyclohexyl)pyridine-4-carboxamide (PubChem CID 114325626) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-methylcyclohexyl)pyridine-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-methylcyclohexyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114325626 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-(aminomethyl)-N-(3-methylcyclohexyl)pyridine-4-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2ccnc(CN)c2)C1 |
| InChI | InChI=1S/C14H21N3O/c1-10-3-2-4-12(7-10)17-14(18)11-5-6-16-13(8-11)9-15/h5-6,8,10,12H,2-4,7,9,15H2,1H3,(H,17,18) |
| InChIKey | VGKVLPSBQVIYNA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |