C17H22N2O — CID 114333213
N-[(2-methoxy-3-pyridinyl)methyl]-4-phenylbutan-1-amine (PubChem CID 114333213) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(2-methoxy-3-pyridinyl)methyl]-4-phenylbutan-1-amine.
| Compound Name | N-[(2-methoxy-3-pyridinyl)methyl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 114333213 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-[(2-methoxy-3-pyridinyl)methyl]-4-phenylbutan-1-amine |
| SMILES | COc1ncccc1CNCCCCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O/c1-20-17-16(11-7-13-19-17)14-18-12-6-5-10-15-8-3-2-4-9-15/h2-4,7-9,11,13,18H,5-6,10,12,14H2,1H3 |
| InChIKey | AAJYFHBGTLXLLH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|