C10H17N3O — CID 21271684
N'-[(2-methoxy-3-pyridinyl)methyl]propane-1,3-diamine (PubChem CID 21271684) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N'-[(2-methoxy-3-pyridinyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(2-methoxy-3-pyridinyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 21271684 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N'-[(2-methoxy-3-pyridinyl)methyl]propane-1,3-diamine |
| SMILES | COc1ncccc1CNCCCN |
| InChI | InChI=1S/C10H17N3O/c1-14-10-9(4-2-7-13-10)8-12-6-3-5-11/h2,4,7,12H,3,5-6,8,11H2,1H3 |
| InChIKey | PKNXTGWLJBGJDW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|