C14H18N2O3S2 — CID 114343646
1-(2,3-dihydroxybenzoyl)-4-methylsulfanylpiperidine-4-carbothioamide (PubChem CID 114343646) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(2,3-dihydroxybenzoyl)-4-methylsulfanylpiperidine-4-carbothioamide.
| Compound Name | 1-(2,3-dihydroxybenzoyl)-4-methylsulfanylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 114343646 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-(2,3-dihydroxybenzoyl)-4-methylsulfanylpiperidine-4-carbothioamide |
| SMILES | CSC1(C(N)=S)CCN(C(=O)c2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-21-14(13(15)20)5-7-16(8-6-14)12(19)9-3-2-4-10(17)11(9)18/h2-4,17-18H,5-8H2,1H3,(H2,15,20) |
| InChIKey | BOFVIVFOUDPPCT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|