C16H13NO4 — CID 114343657
1-(2,3-dihydroxybenzoyl)-2,3-dihydroquinolin-4-one (PubChem CID 114343657) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-(2,3-dihydroxybenzoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(2,3-dihydroxybenzoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 114343657 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(2,3-dihydroxybenzoyl)-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)c2cccc(O)c2O)c2ccccc21 |
| InChI | InChI=1S/C16H13NO4/c18-13-8-9-17(12-6-2-1-4-10(12)13)16(21)11-5-3-7-14(19)15(11)20/h1-7,19-20H,8-9H2 |
| InChIKey | IBFYPWYSBSJGFE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|