C12H14N2O4 — CID 114343719
(2,3-dihydroxyphenyl)-(4-hydroxyiminopiperidin-1-yl)methanone (PubChem CID 114343719) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl)-(4-hydroxyiminopiperidin-1-yl)methanone.
| Compound Name | (2,3-dihydroxyphenyl)-(4-hydroxyiminopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114343719 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2,3-dihydroxyphenyl)-(4-hydroxyiminopiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(O)c1O)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C12H14N2O4/c15-10-3-1-2-9(11(10)16)12(17)14-6-4-8(13-18)5-7-14/h1-3,15-16,18H,4-7H2 |
| InChIKey | XSGGNMSIBDRDNT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|