C14H22N4O2 — CID 114350675
2-amino-3-(4-hydroxyphenyl)-N-(4-methylpiperazin-1-yl)propanamide (PubChem CID 114350675) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)-N-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)-N-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 114350675 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)-N-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CN1CCN(NC(=O)C(N)Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-17-6-8-18(9-7-17)16-14(20)13(15)10-11-2-4-12(19)5-3-11/h2-5,13,19H,6-10,15H2,1H3,(H,16,20) |
| InChIKey | PZGCSXSVEPQNAF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |