C9H19N5O2 — CID 83015245
2-amino-N-(4-methylpiperazin-1-yl)butanediamide (PubChem CID 83015245) has the molecular formula C9H19N5O2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-amino-N-(4-methylpiperazin-1-yl)butanediamide.
| Compound Name | 2-amino-N-(4-methylpiperazin-1-yl)butanediamide |
|---|---|
| PubChem CID | 83015245 |
| Molecular Formula | C9H19N5O2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-amino-N-(4-methylpiperazin-1-yl)butanediamide |
| SMILES | CN1CCN(NC(=O)C(N)CC(N)=O)CC1 |
| InChI | InChI=1S/C9H19N5O2/c1-13-2-4-14(5-3-13)12-9(16)7(10)6-8(11)15/h7H,2-6,10H2,1H3,(H2,11,15)(H,12,16) |
| InChIKey | YDBZMXSQIUAXFS-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |