About [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate
[(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate (PubChem CID 11435132) has the molecular formula C5H12N2O2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate |
| PubChem CID | 11435132 |
| Molecular Formula | C5H12N2O2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate |
| SMILES | CC/S(C)=N/OC(=O)NC |
| InChI | InChI=1S/C5H12N2O2S/c1-4-10(3)7-9-5(8)6-2/h4H2,1-3H3,(H,6,8) |
| InChIKey | PYDKVOKRMPTKKR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate?
The IUPAC name of [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate (CID 11435132) is [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate.
What is the SMILES notation for [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate?
The canonical SMILES for [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate is CC/S(C)=N/OC(=O)NC.
What is the InChIKey of [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate?
The InChIKey is PYDKVOKRMPTKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2S/c1-4-10(3)7-9-5(8)6-2/h4H2,1-3H3,(H,6,8).
What are the key properties of [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate?
[(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate has a molecular weight of 164.23 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[ethyl(methyl)-λ4-sulfanylidene]amino] N-methylcarbamate is sourced from PubChem (CID 11435132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).