About 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate
2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate (PubChem CID 173461736) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate.
Molecular Properties
| Compound Name | 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate |
| PubChem CID | 173461736 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate |
| SMILES | CCC(=NOC(=O)NC)SCC(C)C |
| InChI | InChI=1S/C9H18N2O2S/c1-5-8(14-6-7(2)3)11-13-9(12)10-4/h7H,5-6H2,1-4H3,(H,10,12) |
| InChIKey | DHDYCIYWGBJXOR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate?
The IUPAC name of 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate (CID 173461736) is 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate.
What is the SMILES notation for 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate?
The canonical SMILES for 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate is CCC(=NOC(=O)NC)SCC(C)C.
What is the InChIKey of 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate?
The InChIKey is DHDYCIYWGBJXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-5-8(14-6-7(2)3)11-13-9(12)10-4/h7H,5-6H2,1-4H3,(H,10,12).
What are the key properties of 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate?
2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate has a molecular weight of 218.32 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(methylcarbamoyloxy)propanimidothioate is sourced from PubChem (CID 173461736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).