C9H18N2O2S2 — CID 173449403
methyl 3-methyl-N-(methylcarbamoyloxy)-3-methylsulfanylbutanimidothioate (PubChem CID 173449403) has the molecular formula C9H18N2O2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is methyl 3-methyl-N-(methylcarbamoyloxy)-3-methylsulfanylbutanimidothioate.
| Compound Name | methyl 3-methyl-N-(methylcarbamoyloxy)-3-methylsulfanylbutanimidothioate |
|---|---|
| PubChem CID | 173449403 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 3-methyl-N-(methylcarbamoyloxy)-3-methylsulfanylbutanimidothioate |
| SMILES | CNC(=O)ON=C(CC(C)(C)SC)SC |
| InChI | InChI=1S/C9H18N2O2S2/c1-9(2,15-5)6-7(14-4)11-13-8(12)10-3/h6H2,1-5H3,(H,10,12) |
| InChIKey | JLISVQCLWANRHI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|