About 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate
2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate (PubChem CID 173461525) has the molecular formula C11H22N2O4S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate.
Molecular Properties
| Compound Name | 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate |
| PubChem CID | 173461525 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate |
| SMILES | CNC(=O)ON=C(CC(C)(C)C)SCCS(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O4S2/c1-11(2,3)8-9(13-17-10(14)12-4)18-6-7-19(5,15)16/h6-8H2,1-5H3,(H,12,14) |
| InChIKey | BPOLKOAVKIKDDQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate?
The IUPAC name of 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate (CID 173461525) is 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate.
What is the SMILES notation for 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate?
The canonical SMILES for 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate is CNC(=O)ON=C(CC(C)(C)C)SCCS(C)(=O)=O.
What is the InChIKey of 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate?
The InChIKey is BPOLKOAVKIKDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4S2/c1-11(2,3)8-9(13-17-10(14)12-4)18-6-7-19(5,15)16/h6-8H2,1-5H3,(H,12,14).
What are the key properties of 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate?
2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate has a molecular weight of 310.44 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonylethyl 3,3-dimethyl-N-(methylcarbamoyloxy)butanimidothioate is sourced from PubChem (CID 173461525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).