C11H20N2O4S — CID 54095220
[[1-(3-methoxy-3-oxopropyl)sulfanyl-3,3-dimethylbutylidene]amino]carbamic acid (PubChem CID 54095220) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is [[1-(3-methoxy-3-oxopropyl)sulfanyl-3,3-dimethylbutylidene]amino]carbamic acid.
| Compound Name | [[1-(3-methoxy-3-oxopropyl)sulfanyl-3,3-dimethylbutylidene]amino]carbamic acid |
|---|---|
| PubChem CID | 54095220 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [[1-(3-methoxy-3-oxopropyl)sulfanyl-3,3-dimethylbutylidene]amino]carbamic acid |
| SMILES | COC(=O)CCSC(CC(C)(C)C)=NNC(=O)O |
| InChI | InChI=1S/C11H20N2O4S/c1-11(2,3)7-8(12-13-10(15)16)18-6-5-9(14)17-4/h13H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | MWQKFOAMOQLUKP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|