C12H16N2O4S2 — CID 139671862
[(Z)-[1-(3-ethoxy-3-oxopropyl)sulfanyl-2-thiophen-2-ylethylidene]amino]carbamic acid (PubChem CID 139671862) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(Z)-[1-(3-ethoxy-3-oxopropyl)sulfanyl-2-thiophen-2-ylethylidene]amino]carbamic acid.
| Compound Name | [(Z)-[1-(3-ethoxy-3-oxopropyl)sulfanyl-2-thiophen-2-ylethylidene]amino]carbamic acid |
|---|---|
| PubChem CID | 139671862 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [(Z)-[1-(3-ethoxy-3-oxopropyl)sulfanyl-2-thiophen-2-ylethylidene]amino]carbamic acid |
| SMILES | CCOC(=O)CCS/C(Cc1cccs1)=N\NC(=O)O |
| InChI | InChI=1S/C12H16N2O4S2/c1-2-18-11(15)5-7-20-10(13-14-12(16)17)8-9-4-3-6-19-9/h3-4,6,14H,2,5,7-8H2,1H3,(H,16,17)/b13-10- |
| InChIKey | RWVRDGBGQZMNQP-RAXLEYEMSA-N |
| XLogP | 2.56 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|