C7H12N2O2S — CID 173461502
ethenyl N-(methylcarbamoyloxy)propanimidothioate (PubChem CID 173461502) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is ethenyl N-(methylcarbamoyloxy)propanimidothioate.
| Compound Name | ethenyl N-(methylcarbamoyloxy)propanimidothioate |
|---|---|
| PubChem CID | 173461502 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | ethenyl N-(methylcarbamoyloxy)propanimidothioate |
| SMILES | C=CSC(CC)=NOC(=O)NC |
| InChI | InChI=1S/C7H12N2O2S/c1-4-6(12-5-2)9-11-7(10)8-3/h5H,2,4H2,1,3H3,(H,8,10) |
| InChIKey | CJDNEEUTOKRXPF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|